Difference between revisions of "RXN-7835"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7835 RXN-7835] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec nu...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7835 RXN-7835] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K
+
 
* common name:
 
* common name:
−
** UDP
+
** NAD(P)-binding domain
−
* molecular weight:
+
* ec number:
−
** 401.14   
+
** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34]
 
* Synonym(s):
 
* Synonym(s):
−
** uridine-diphosphate
 
−
** uridine-5'-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-722]]
+
* With identifiers:
−
* [[UDPKIN-RXN]]
+
** 1 [[NADPH]][c] '''+''' 1 [[2-trans-4-cis-dienoyl-CoAs]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Trans-3-enoyl-CoAs]][c] '''+''' 1 [[NADP]][c]
−
* [[RXN-12197]]
+
* With common name(s):
−
* [[UDPREDUCT-RXN]]
+
** 1 NADPH[c] '''+''' 1 a 2-trans-4-cis-dienoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 a trans-3-enoyl-CoA[c] '''+''' 1 NADP+[c]
−
== Reaction(s) known to produce the compound ==
+
 
−
* [[2.4.1.145-RXN]]
+
== Genes associated with this reaction  ==
−
* [[2.4.1.149-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[2.4.1.223-RXN]]
+
* Gene: [[Ec-16_003950]]
−
* [[RXN1F-461]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[2.4.1.151-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[RXN-4726]]
+
== Pathways  ==
−
* [[2.4.1.141-RXN]]
+
* [[PWY-5138]], unsaturated, even numbered fatty acid β-oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138]
−
* [[2.4.1.144-RXN]]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
−
* [[2.4.1.150-RXN]]
+
== Reconstruction information  ==
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
* Category: [[annotation]]
−
* [[2.4.1.101-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[2.4.1.201-RXN]]
+
*** Tool: [[pathwaytools]]
−
* [[RXN-1224]]
+
−
* [[RXN-1225]]
+
−
* [[RXN-7828]]
+
−
* [[TREHALOSE6PSYN-RXN]]
+
−
* [[RXN-4733]]
+
−
* [[RXN-8228]]
+
−
* [[2.4.1.46-RXN]]
+
−
* [[RXN-15278]]
+
−
* [[2.4.1.117-RXN]]
+
−
* [[RXN-15277]]
+
−
* [[RXN-15276]]
+
−
* [[RXN1F-462]]
+
−
* [[2.4.1.155-RXN]]
+
−
* [[2.4.1.143-RXN]]
+
−
* [[RXN-12002]]
+
−
* [[2.4.1.38-RXN]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[2.4.2.38-RXN]]
+
−
* [[RXN-7873]]
+
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
−
* [[RXN-16027]]
+
−
* [[RXN-12196]]
+
−
* [[2.4.1.229-RXN]]
+
−
* [[LACTOSE-SYNTHASE-RXN]]
+
−
* [[2.4.1.198-RXN]]
+
−
* [[RXN-15117]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 58-98-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 33518
+
{{#set: common name=NAD(P)-binding domain}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.34}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20056717 20056717]
+
{{#set: gene associated=Ec-16_003950}}
−
* KNAPSACK : C00007313
+
{{#set: in pathway=PWY-5138}}
−
* HMDB : HMDB00295
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00015 C00015]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.16739715.html 16739715]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58223 58223]
+
−
* METABOLIGHTS : MTBLC58223
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=XCCTYIAWTASOJW-XVFCMESISA-K}}
+
−
{{#set: common name=UDP}}
+
−
{{#set: molecular weight=401.14    }}
+
−
{{#set: common name=uridine-diphosphate|uridine-5'-diphosphate}}
+
−
{{#set: consumed by=RXN0-722|UDPKIN-RXN|RXN-12197|UDPREDUCT-RXN}}
+
−
{{#set: produced by=2.4.1.145-RXN|2.4.1.149-RXN|2.4.1.223-RXN|RXN1F-461|2.4.1.151-RXN|RXN-4726|2.4.1.141-RXN|2.4.1.144-RXN|2.4.1.150-RXN|CELLULOSE-SYNTHASE-UDP-FORMING-RXN|2.4.1.101-RXN|2.4.1.201-RXN|RXN-1224|RXN-1225|RXN-7828|TREHALOSE6PSYN-RXN|RXN-4733|RXN-8228|2.4.1.46-RXN|RXN-15278|2.4.1.117-RXN|RXN-15277|RXN-15276|RXN1F-462|2.4.1.155-RXN|2.4.1.143-RXN|RXN-12002|2.4.1.38-RXN}}
+
−
{{#set: reversible reaction associated=2.4.2.38-RXN|RXN-7873|13-BETA-GLUCAN-SYNTHASE-RXN|RXN-16027|RXN-12196|2.4.1.229-RXN|LACTOSE-SYNTHASE-RXN|2.4.1.198-RXN|RXN-15117}}
+

Latest revision as of 20:10, 21 March 2018

Reaction RXN-7835

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5138, unsaturated, even numbered fatty acid β-oxidation: PWY-5138
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7835&oldid=25060"