Difference between revisions of "PYRROLINE-HYDROXY-CARBOXYLATE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_002260 == * left end position: ** 1965583 * transcription direction: ** NEGATIVE * right end position: ** 1976166 * centisome position: ** 30.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * smiles: ** C1(=NC(C([O-])=O)C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=NC(C([O-])=O)CC(O)1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M |
− | * | + | * common name: |
− | ** | + | ** (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate |
− | * | + | * molecular weight: |
− | ** | + | ** 128.107 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-Δ1-pyrroline 3-hydroxy-5-carboxylate |
− | ** | + | ** L-1pyrroline-3-hydroxy-5-carboxylate |
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN66-546]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281] |
+ | * HMDB : HMDB01369 | ||
+ | {{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}} | ||
+ | {{#set: common name=(3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate}} | ||
+ | {{#set: molecular weight=128.107 }} | ||
+ | {{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1pyrroline-3-hydroxy-5-carboxylate}} | ||
+ | {{#set: consumed by=RXN66-546}} |
Latest revision as of 19:11, 21 March 2018
Contents
Metabolite PYRROLINE-HYDROXY-CARBOXYLATE
- smiles:
- C1(=NC(C([O-])=O)CC(O)1)
- inchi key:
- InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
- common name:
- (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate
- molecular weight:
- 128.107
- Synonym(s):
- L-Δ1-pyrroline 3-hydroxy-5-carboxylate
- L-1pyrroline-3-hydroxy-5-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=NC(C([O-])=O)CC(O)1)" cannot be used as a page name in this wiki.