Difference between revisions of "PWY-7274"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-20...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-2062] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-cycloserine biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[SERINE-O-ACETTRAN-RXN]] | |
| − | * [[ | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-22_002810]] |
| − | * [[ | + | *** [[Ec-00_004310]] |
| + | *** [[Ec-24_003520]] | ||
| + | *** [[Ec-01_001610]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12537 RXN-12537] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14457 RXN-14457] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14458 RXN-14458] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14459 RXN-14459] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14460 RXN-14460] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2062}} | |
| − | + | {{#set: common name=D-cycloserine biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:11, 21 March 2018
Pathway PWY-7274
- taxonomic range:
- common name:
- D-cycloserine biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- SERINE-O-ACETTRAN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
