Difference between revisions of "PWY-7177"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** UTP and CTP dephosphorylation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** pyrimidine nucleotides dephosphorylation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | * [[ | + | * [[CTPSYN-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[ | + | *** [[Ec-20_000910]] |
− | + | *** [[Ec-00_000570]] | |
− | + | ** 2 reconstruction source(s) associated: | |
− | * [[ | + | *** [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** [[orthology-aragem]] |
+ | * [[RXN-12199]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-02_001970]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-12200]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-02_001970]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=UTP and CTP dephosphorylation II}} | |
− | + | {{#set: common name=pyrimidine nucleotides dephosphorylation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Pathway PWY-7177
- taxonomic range:
- common name:
- UTP and CTP dephosphorylation II
- Synonym(s):
- pyrimidine nucleotides dephosphorylation
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- CTPSYN-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-12199
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-12200
- 1 associated gene(s):
- 1 reconstruction source(s) associated: