Difference between revisions of "RXN0-1441"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] == * direction: ** LEFT-TO-RIGHT * common name: ** NUDIX hydrolase * ec number...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1441 RXN0-1441] ==
−
* smiles:
+
* direction:
−
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** cyanidin
+
** NUDIX hydrolase
−
* molecular weight:
+
* ec number:
−
** 285.232   
+
** [http://enzyme.expasy.org/EC/3.6.1.53 EC-3.6.1.53]
 +
** [http://enzyme.expasy.org/EC/3.6.1.13 EC-3.6.1.13]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 
−
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 
−
** 3,3',4',5,7-pentahydroxyflavylium
 
−
** cyanidol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9725]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMP]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-15317]][c]
−
* [[RXN-602]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 ADP-D-ribose[c] '''+''' 1 H2O[c] '''=>''' 1 AMP[c] '''+''' 2 H+[c] '''+''' 1 D-ribofuranose 5-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_006940]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-19_002730]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10412 10412]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01054 R01054]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
+
{{#set: common name=NUDIX hydrolase}}
−
* HMDB : HMDB02708
+
{{#set: ec number=EC-3.6.1.53}}
−
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
+
{{#set: ec number=EC-3.6.1.13}}
−
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
+
{{#set: gene associated=Ec-07_006940|Ec-19_002730}}
−
{{#set: common name=cyanidin}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=285.232    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: consumed by=RXN-9725}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN-602}}
+

Latest revision as of 19:12, 21 March 2018

Reaction RXN0-1441

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-1441&oldid=25272"