Difference between revisions of "Ec-20 000940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-20_000940 == * left end position: ** 891809 * transcription direction: ** POSITIVE * right end position: ** 904680 * centisome position: ** 17.295...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+
== Gene Ec-20_000940 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 891809
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-methyl-3-oxo-4-hexenoyl-CoA
+
** 904680
−
* molecular weight:
+
* centisome position:
−
** 887.641    
+
** 17.295116    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0195_0025
 +
** Esi0195_0025
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11921]]
+
* Reaction: [[2.7.10.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=891809}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=904680}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471]
+
{{#set: centisome position=17.295116    }}
−
* HMDB : HMDB60399
+
{{#set: common name=Esi_0195_0025|Esi0195_0025}}
−
{{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}}
+
−
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}}
+
−
{{#set: molecular weight=887.641    }}
+
−
{{#set: consumed by=RXN-11921}}
+

Latest revision as of 19:12, 21 March 2018

Gene Ec-20_000940

  • left end position:
    • 891809
  • transcription direction:
    • POSITIVE
  • right end position:
    • 904680
  • centisome position:
    • 17.295116
  • Synonym(s):
    • Esi_0195_0025
    • Esi0195_0025

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_000940&oldid=25307"