Difference between revisions of "CPD-17050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5154 PWY-5154] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
 +
* inchi key:
 +
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
 
* common name:
 
* common name:
** L-arginine biosynthesis III (via N-acetyl-L-citrulline)
+
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
 +
* molecular weight:
 +
** 296.358   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''7''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN-15684]]
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Ec-24_000610]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[ACETYLORNTRANSAM-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-14_006580]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[ARGSUCCINLYA-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-12_005890]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[ARGSUCCINSYN-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-01_001870]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[CARBPSYN-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-10_006110]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-21_003520]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[N-ACETYLTRANSFER-RXN]]
+
** 2 associated gene(s):
+
*** [[Ec-14_006230]]
+
*** [[Ec-07_005560]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.3.9-RXN 2.1.3.9-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7933 RXN-7933]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=L-arginine biosynthesis III (via N-acetyl-L-citrulline)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
{{#set: reaction found=7}}
+
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
{{#set: total reaction=9}}
+
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
{{#set: completion rate=78.0}}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
 +
{{#set: molecular weight=296.358    }}
 +
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: produced by=RXN-15684}}

Latest revision as of 19:12, 21 March 2018

Metabolite CPD-17050

  • smiles:
    • C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
  • inchi key:
    • InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 296.358
  • Synonym(s):
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links