Difference between revisions of "RXN-10062"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-hexacos-2-enoyl-[acp]...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] ==
−
* smiles:
+
* direction:
−
** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N
+
 
* common name:
 
* common name:
−
** L-cystine
+
** trans-hexacos-2-enoyl-[acp] reductase
−
* molecular weight:
+
** Glucose/ribitol dehydrogenase
−
** 240.292   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[CYSTHIOCYS-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Cerotoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-15128]]
+
** 1 a trans-hexacos-2-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 a cerotoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
 +
** '''7''' reactions found over '''12''' reactions in the full pathway
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 24645-67-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=trans-hexacos-2-enoyl-[acp] reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992103 6992103]
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
* HMDB : HMDB00192
+
{{#set: ec number=EC-1.3.1.9}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-27_002470}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01420 C01420]
+
{{#set: in pathway=PWY-6113|PWYG-321}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35491 35491]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* METABOLIGHTS : MTBLC35491
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]}}
+
−
{{#set: inchi key=InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N}}
+
−
{{#set: common name=L-cystine}}
+
−
{{#set: molecular weight=240.292    }}
+
−
{{#set: consumed by=CYSTHIOCYS-RXN}}
+
−
{{#set: reversible reaction associated=RXN-15128}}
+

Latest revision as of 19:12, 21 March 2018

Reaction RXN-10062

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-hexacos-2-enoyl-[acp] reductase
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6113, superpathway of mycolate biosynthesis: PWY-6113
    • 7 reactions found over 12 reactions in the full pathway
  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-hexacos-2-enoyl-[acp] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10062&oldid=25327"