Difference between revisions of "RXN0-1461"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1461 RXN0-1461] == * direction: ** LEFT-TO-RIGHT * common name: ** coproporphyrinogen oxidase,...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1461 RXN0-1461] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** coproporphyrinogen oxidase, putative chloroplast precursor |
− | * | + | ** coproporphyrinogen oxidase (aerobic), putative chloroplast precursor |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.3.3 EC-1.3.3.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 2 [[PROTON]][c] '''+''' 1 [[COPROPORPHYRINOGEN_III]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTOPORPHYRINOGEN]][c] '''+''' 2 [[CARBON-DIOXIDE]][c] '''+''' 2 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 2 H+[c] '''+''' 1 coproporphyrinogen III[c] '''+''' 1 oxygen[c] '''=>''' 1 protoporphyrinogen IX[c] '''+''' 2 CO2[c] '''+''' 2 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-08_001470]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-19_005390]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY0-1415]], superpathway of heme biosynthesis from uroporphyrinogen-III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1415 PWY0-1415] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[HEME-BIOSYNTHESIS-II]], heme biosynthesis I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEME-BIOSYNTHESIS-II HEME-BIOSYNTHESIS-II] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18257 18257] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03220 R03220] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9RLE1 Q9RLE1] |
− | * | + | ** [http://www.uniprot.org/uniprot/P36552 P36552] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O25376 O25376] |
− | * | + | ** [http://www.uniprot.org/uniprot/P36553 P36553] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P33771 P33771] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43899 P43899] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O25824 O25824] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P54304 P54304] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11353 P11353] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q8X8G8 Q8X8G8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9ZC86 Q9ZC86] |
+ | ** [http://www.uniprot.org/uniprot/P36551 P36551] | ||
+ | ** [http://www.uniprot.org/uniprot/P35055 P35055] | ||
+ | ** [http://www.uniprot.org/uniprot/P43898 P43898] | ||
+ | ** [http://www.uniprot.org/uniprot/P72848 P72848] | ||
+ | ** [http://www.uniprot.org/uniprot/P73245 P73245] | ||
+ | ** [http://www.uniprot.org/uniprot/P74132 P74132] | ||
+ | ** [http://www.uniprot.org/uniprot/Q51676 Q51676] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42946 Q42946] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42840 Q42840] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39581 Q39581] | ||
+ | ** [http://www.uniprot.org/uniprot/P95651 P95651] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RFG1 Q9RFG1] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=coproporphyrinogen oxidase, putative chloroplast precursor}} | ||
+ | {{#set: common name=coproporphyrinogen oxidase (aerobic), putative chloroplast precursor}} | ||
+ | {{#set: ec number=EC-1.3.3.3}} | ||
+ | {{#set: gene associated=Ec-08_001470|Ec-19_005390}} | ||
+ | {{#set: in pathway=PWY0-1415|HEME-BIOSYNTHESIS-II|CHLOROPHYLL-SYN|PWY-7159}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction RXN0-1461
- direction:
- LEFT-TO-RIGHT
- common name:
- coproporphyrinogen oxidase, putative chloroplast precursor
- coproporphyrinogen oxidase (aerobic), putative chloroplast precursor
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 PROTON[c] + 1 COPROPORPHYRINOGEN_III[c] + 1 OXYGEN-MOLECULE[c] => 1 PROTOPORPHYRINOGEN[c] + 2 CARBON-DIOXIDE[c] + 2 WATER[c]
- With common name(s):
- 2 H+[c] + 1 coproporphyrinogen III[c] + 1 oxygen[c] => 1 protoporphyrinogen IX[c] + 2 CO2[c] + 2 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-08_001470
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-19_005390
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY0-1415, superpathway of heme biosynthesis from uroporphyrinogen-III: PWY0-1415
- 5 reactions found over 6 reactions in the full pathway
- HEME-BIOSYNTHESIS-II, heme biosynthesis I (aerobic): HEME-BIOSYNTHESIS-II
- 4 reactions found over 4 reactions in the full pathway
- CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
- 6 reactions found over 9 reactions in the full pathway
- PWY-7159, 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): PWY-7159
- 5 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: