Difference between revisions of "RXN0-6725"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6725 RXN0-6725] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6725 RXN0-6725] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J
+
 
* common name:
 
* common name:
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
+
** phospholipase A2
−
* molecular weight:
+
* ec number:
−
** 1073.981   
+
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** docosapentaenoyl-2-enoyl-CoA
 
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13445]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[L-1-PHOSPHATIDYL-ETHANOLAMINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[2-LYSOPHOSPHATIDYLETHANOLAMINES]][c] '''+''' 1 [[Fatty-Acids]][c]
−
* [[RXN-13444]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 an L-1-phosphatidylethanolamine[c] '''=>''' 1 H+[c] '''+''' 1 a 1-acyl 2-lyso-phosphatidylethanolamine[c] '''+''' 1 a fatty acid[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_005150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551532 72551532]
+
{{#set: common name=phospholipase A2}}
−
* CHEBI:
+
{{#set: ec number=EC-3.1.1.4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76461 76461]
+
{{#set: gene associated=Ec-04_004650|Ec-21_005150}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=(2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=1073.981    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=docosapentaenoyl-2-enoyl-CoA|(2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13445}}
+
−
{{#set: produced by=RXN-13444}}
+

Latest revision as of 19:13, 21 March 2018

Reaction RXN0-6725

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-6725&oldid=25439"