Difference between revisions of "Ec-06 010220"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Gene == Gene Ec-06_010220 == * left end position: ** 7994025 * transcription direction: ** NEGATIVE * right end position: ** 8000514 * centisome position: ** 91.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_010220 == |
− | * | + | * left end position: |
− | ** | + | ** 7994025 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 8000514 |
− | * | + | * centisome position: |
− | ** | + | ** 91.27936 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0136_0068 | ||
+ | ** Esi0136_0068 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[ATPSYN-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7994025}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=8000514}} |
− | {{#set: | + | {{#set: centisome position=91.27936 }} |
− | {{#set: common name= | + | {{#set: common name=Esi_0136_0068|Esi0136_0068}} |
− | {{#set: | + | {{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7219}} |
Latest revision as of 19:13, 21 March 2018
Gene Ec-06_010220
- left end position:
- 7994025
- transcription direction:
- NEGATIVE
- right end position:
- 8000514
- centisome position:
- 91.27936
- Synonym(s):
- Esi_0136_0068
- Esi0136_0068
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-aragem
- Reaction: ATPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome