Difference between revisions of "Ec-18 002510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
(Created page with "Category:Gene == Gene Ec-18_002510 == * left end position: ** 2466900 * transcription direction: ** POSITIVE * right end position: ** 2467984 * centisome position: ** 50.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_002510 == |
− | * | + | * left end position: |
− | ** | + | ** 2466900 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2467984 |
− | * | + | * centisome position: |
− | ** | + | ** 50.07351 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0053_0116 |
− | ** | + | ** Esi0053_0116 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[HISTONE-ACETYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2466900}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2467984}} | |
− | + | {{#set: centisome position=50.07351 }} | |
− | + | {{#set: common name=Esi_0053_0116|Esi0053_0116}} | |
− | + | {{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:14, 21 March 2018
Gene Ec-18_002510
- left end position:
- 2466900
- transcription direction:
- POSITIVE
- right end position:
- 2467984
- centisome position:
- 50.07351
- Synonym(s):
- Esi_0053_0116
- Esi0053_0116
Reactions associated
- Reaction: HISTONE-ACETYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome