Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GALDEG-PWY GALDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == * smiles: ** C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3))) |
| + | * inchi key: | ||
| + | ** InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (+)-dihydrokaempferol |
| + | * molecular weight: | ||
| + | ** 288.256 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (+)-aromadendrin |
| + | ** (2R,3R)-dihydrokaempferol | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN1F-93]] | |
| − | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 480-20-6 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122850 122850] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15401 15401] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC15401 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00974 C00974] | ||
| + | {{#set: smiles=C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))}} | ||
| + | {{#set: inchi key=InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N}} | ||
| + | {{#set: common name=(+)-dihydrokaempferol}} | ||
| + | {{#set: molecular weight=288.256 }} | ||
| + | {{#set: common name=(+)-aromadendrin|(2R,3R)-dihydrokaempferol}} | ||
| + | {{#set: consumed by=RXN1F-93|DIHYDROKAEMPFEROL-4-REDUCTASE-RXN}} | ||
| + | {{#set: produced by=NARINGENIN-3-DIOXYGENASE-RXN}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- smiles:
- C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))
- inchi key:
- InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N
- common name:
- (+)-dihydrokaempferol
- molecular weight:
- 288.256
- Synonym(s):
- (+)-aromadendrin
- (2R,3R)-dihydrokaempferol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
