Difference between revisions of "CPD-12115"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183939 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183939 TAX-183939]
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-51290 TAX-51290]
+
** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
+
 
* common name:
 
* common name:
−
** L-lysine biosynthesis VI
+
** demethylmenaquinol-8
 +
* molecular weight:
 +
** 705.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-demethylmenaquinol-8
 +
** DMKH2-8
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''7''' reactions found over '''7''' reactions in the full pathway
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
−
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-01_007470]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[ASPARTATEKIN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-24_000610]]
+
−
*** [[Ec-11_000830]]
+
−
*** [[Ec-27_003730]]
+
−
*** [[Ec-13_002530]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[DIAMINOPIMDECARB-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-01_000060]]
+
−
*** [[Ec-09_002360]]
+
−
*** [[Ec-09_002410]]
+
−
*** [[Ec-09_002420]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[DIAMINOPIMEPIM-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-06_009100]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[DIHYDRODIPICSYN-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
* [[RXN-14014]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-15_000750]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-7737]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-14_005830]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5097 PWY-5097]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277]
−
{{#set: taxonomic range=TAX-183939}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-183925}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873]
−
{{#set: taxonomic range=TAX-51290}}
+
* BIGG : 1438263
−
{{#set: taxonomic range=TAX-1117}}
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}}
−
{{#set: taxonomic range=TAX-3398}}
+
{{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}}
−
{{#set: common name=L-lysine biosynthesis VI}}
+
{{#set: common name=demethylmenaquinol-8}}
−
{{#set: reaction found=7}}
+
{{#set: molecular weight=705.118    }}
−
{{#set: total reaction=7}}
+
{{#set: common name=2-demethylmenaquinol-8|DMKH2-8}}
−
{{#set: completion rate=100.0}}
+
{{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}}

Latest revision as of 19:15, 21 March 2018

Metabolite CPD-12115

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
  • inchi key:
    • InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
  • common name:
    • demethylmenaquinol-8
  • molecular weight:
    • 705.118
  • Synonym(s):
    • 2-demethylmenaquinol-8
    • DMKH2-8

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12115&oldid=25578"