Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-CYCLODEAMINASE-RXN ORNITHINE-CYCLODEAMINASE-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-CYCLODEAMINASE-RXN ORNITHINE-CYCLODEAMINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Ornithine cyclodeaminase/mu-crystallin |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.3.1.12 EC-4.3.1.12] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[L-ORNITHINE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PRO]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 L-ornithine[c] '''=>''' 1 ammonium[c] '''+''' 1 L-proline[c] |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-18_004550]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[ORN-AMINOPENTANOATE-CAT-PWY]], L-ornithine degradation I (L-proline biosynthesis): [http://metacyc.org/META/NEW-IMAGE?object=ORN-AMINOPENTANOATE-CAT-PWY ORN-AMINOPENTANOATE-CAT-PWY] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[ARG-GLU-PWY]], L-arginine degradation VII (arginase 3 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-GLU-PWY ARG-GLU-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24368 24368] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00671 R00671] | |
− | ** [http:// | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/Q59701 Q59701] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P09773 P09773] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P33728 P33728] |
− | * | + | ** [http://www.uniprot.org/uniprot/O68052 O68052] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9WWA2 Q9WWA2] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www. | + | {{#set: common name=Ornithine cyclodeaminase/mu-crystallin}} |
− | * | + | {{#set: ec number=EC-4.3.1.12}} |
− | + | {{#set: gene associated=Ec-18_004550}} | |
− | {{#set: | + | {{#set: in pathway=ORN-AMINOPENTANOATE-CAT-PWY|ARG-GLU-PWY}} |
− | {{#set: common name= | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:16, 21 March 2018
Contents
Reaction ORNITHINE-CYCLODEAMINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Ornithine cyclodeaminase/mu-crystallin
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-ORNITHINE[c] => 1 AMMONIUM[c] + 1 PRO[c]
- With common name(s):
- 1 L-ornithine[c] => 1 ammonium[c] + 1 L-proline[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-18_004550
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- ORN-AMINOPENTANOATE-CAT-PWY, L-ornithine degradation I (L-proline biosynthesis): ORN-AMINOPENTANOATE-CAT-PWY
- 1 reactions found over 1 reactions in the full pathway
- ARG-GLU-PWY, L-arginine degradation VII (arginase 3 pathway): ARG-GLU-PWY
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links