Difference between revisions of "PWY-6871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-METHYL-MALONYL-COA D-METHYL-MALONYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6871 PWY-6871] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4891 TAX-48...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-METHYL-MALONYL-COA D-METHYL-MALONYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6871 PWY-6871] ==
* smiles:
+
* taxonomic range:
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4891 TAX-4891]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=MZFOKIKEPGUZEN-IBNUZSNCSA-I
+
 
* common name:
 
* common name:
** (S)-methylmalonyl-CoA
+
** 3-methylbutanol biosynthesis (engineered)
* molecular weight:
+
** 862.568   
+
 
* Synonym(s):
 
* Synonym(s):
** D-methylmalonyl-CoA
 
** methyl-malonyl-coenzyme A
 
** CH3-malonyl-CoA
 
** (2S)-methyl-malonyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[2-ISOPROPYLMALATESYN-RXN]]
* [[PROPIONYL-COA-CARBOXY-RXN]]
+
** 2 associated gene(s):
 +
*** [[Ec-28_002630]]
 +
*** [[Ec-18_000460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_002120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-sdr_f_000030]]
 +
*** [[Ec-13_001950]]
 +
*** [[Ec-12_000170]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-7800]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-8991]]
 +
** 3 associated gene(s):
 +
*** [[Ec-13_001950]]
 +
*** [[Ec-12_000170]]
 +
*** [[Ec-sdr_f_000030]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7692 RXN-7692]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7693 RXN-7693]
 
== External links  ==
 
== External links  ==
* CAS : 104809-02-1
+
{{#set: taxonomic range=TAX-4891}}
* BIGG : 35689
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=3-methylbutanol biosynthesis (engineered)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266561 45266561]
+
{{#set: reaction found=5}}
* HMDB : HMDB01269
+
{{#set: total reaction=7}}
* LIGAND-CPD:
+
{{#set: completion rate=71.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00683 C00683]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57327 57327]
+
* METABOLIGHTS : MTBLC57327
+
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O}}
+
{{#set: inchi key=InChIKey=MZFOKIKEPGUZEN-IBNUZSNCSA-I}}
+
{{#set: common name=(S)-methylmalonyl-CoA}}
+
{{#set: molecular weight=862.568    }}
+
{{#set: common name=D-methylmalonyl-CoA|methyl-malonyl-coenzyme A|CH3-malonyl-CoA|(2S)-methyl-malonyl-CoA}}
+
{{#set: reversible reaction associated=PROPIONYL-COA-CARBOXY-RXN}}
+

Latest revision as of 19:16, 21 March 2018

Pathway PWY-6871

  • taxonomic range:
  • common name:
    • 3-methylbutanol biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links