Difference between revisions of "Ec-24 001390"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-24_001390 == * left end position: ** 1590918 * transcription direction: ** POSITIVE * right end position: ** 1596835 * centisome position: ** 31.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_001390 == |
− | * | + | * left end position: |
− | ** | + | ** 1590918 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1596835 |
− | * | + | * centisome position: |
− | ** | + | ** 31.897005 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0019_0190 |
− | ** | + | ** Esi0019_0190 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=1590918}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1596835}} | |
− | + | {{#set: centisome position=31.897005 }} | |
− | + | {{#set: common name=Esi_0019_0190|Esi0019_0190}} | |
− | + | {{#set: reaction associated=PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:17, 21 March 2018
Gene Ec-24_001390
- left end position:
- 1590918
- transcription direction:
- POSITIVE
- right end position:
- 1596835
- centisome position:
- 31.897005
- Synonym(s):
- Esi_0019_0190
- Esi0019_0190
Reactions associated
- Reaction: PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome