Difference between revisions of "RXN-16114"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16114 RXN-16114] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16114 RXN-16114] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.3.1.93 EC-1.3.1.93] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-17368]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-17323]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 trans-adre-2-enoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 adrenoyl-CoA[c] | |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
− | + | * [[PWY-7728]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis II (4-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7728 PWY-7728] | |
− | + | ** '''4''' reactions found over '''5''' reactions in the full pathway | |
− | * | + | * [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] |
− | * [[ | + | ** '''13''' reactions found over '''13''' reactions in the full pathway |
− | + | == Reconstruction information == | |
− | * [[ | + | * Category: [[annotation]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.3.1.93}} | |
− | + | {{#set: in pathway=PWY-7728|PWY-7726}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:17, 21 March 2018
Contents
Reaction RXN-16114
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H+[c] + 1 NADPH[c] + 1 trans-adre-2-enoyl-CoA[c] => 1 NADP+[c] + 1 adrenoyl-CoA[c]
Genes associated with this reaction
Pathways
- PWY-7728, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis II (4-desaturase): PWY-7728
- 4 reactions found over 5 reactions in the full pathway
- PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
- 13 reactions found over 13 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome