Difference between revisions of "PWY-5026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPOXYSQUALENE EPOXYSQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC[CH]1(C(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPOXYSQUALENE EPOXYSQUALENE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC[CH]1(C(C)(C)O1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=QYIMSPSDBYKPPY-RSKUXYSASA-N
+
 
* common name:
 
* common name:
−
** (3S)-2,3-epoxy-2,3-dihydrosqualene
+
** indole-3-acetate biosynthesis V (bacteria and fungi)
−
* molecular weight:
+
−
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
−
** squalene 2,3-epoxide
+
** IAA biosynthesis V (bacteria and fungi)
−
** squalene 2,3-oxide
+
−
** (S)-squalene-2,3-epoxide
+
−
** 2,3-EDSQ
+
−
** 2,3-epoxisqualene
+
−
** oxidosqualene
+
−
** 2,3-oxidosqualene
+
−
** (3S)-2,3-epoxysqualene
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-1404]]
−
* [[SQUALENE-MONOOXYGENASE-RXN]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_002370]]
 +
*** [[Ec-26_000350]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 9029-62-3
+
{{#set: taxonomic range=TAX-1224}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459811 5459811]
+
{{#set: common name=indole-3-acetate biosynthesis V (bacteria and fungi)}}
−
* HMDB : HMDB01188
+
{{#set: common name=IAA biosynthesis V (bacteria and fungi)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01054 C01054]
+
{{#set: total reaction=1}}
−
* CHEMSPIDER:
+
{{#set: completion rate=100.0}}
−
** [http://www.chemspider.com/Chemical-Structure.4444080.html 4444080]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15441 15441]
+
−
* METABOLIGHTS : MTBLC15441
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC[CH]1(C(C)(C)O1)}}
+
−
{{#set: inchi key=InChIKey=QYIMSPSDBYKPPY-RSKUXYSASA-N}}
+
−
{{#set: common name=(3S)-2,3-epoxy-2,3-dihydrosqualene}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=squalene 2,3-epoxide|squalene 2,3-oxide|(S)-squalene-2,3-epoxide|2,3-EDSQ|2,3-epoxisqualene|oxidosqualene|2,3-oxidosqualene|(3S)-2,3-epoxysqualene}}
+
−
{{#set: consumed by=CYCLOARTENOL-SYNTHASE-RXN}}
+
−
{{#set: produced by=SQUALENE-MONOOXYGENASE-RXN}}
+

Latest revision as of 19:17, 21 March 2018

Pathway PWY-5026

  • taxonomic range:
  • common name:
    • indole-3-acetate biosynthesis V (bacteria and fungi)
  • Synonym(s):
    • IAA biosynthesis V (bacteria and fungi)

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5026&oldid=25876"