Difference between revisions of "Ec-10 006110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Ec-10_006110 == * left end position: ** 6197821 * transcription direction: ** POSITIVE * right end position: ** 6217558 * centisome position: ** 95.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
+
== Gene Ec-10_006110 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
+
** 6197821
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** phytenal
+
** 6217558
−
* molecular weight:
+
* centisome position:
−
** 294.52    
+
** 95.33665    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E-phytenal
+
** Esi_0006_0183
−
** 3,7,11,15-tetramethyl-2E-hexadecenal
+
** Esi0006_0183
 +
** CPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-479]]
+
* Reaction: [[CARBPSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[GLUTAMIN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-13202]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-14196]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16909]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16910]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-4984]]
 +
* [[GLUTAMINDEG-PWY]]
 +
* [[ARGSYN-PWY]]
 +
* [[PWY-5154]]
 +
* [[ARGSYNBSUB-PWY]]
 +
* [[PWY-7693]]
 +
* [[PWY-7400]]
 +
* [[PWY-5686]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104010025
+
{{#set: left end position=6197821}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
+
{{#set: right end position=6217558}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
+
{{#set: centisome position=95.33665   }}
−
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
+
{{#set: common name=Esi_0006_0183|Esi0006_0183|CPS}}
−
{{#set: common name=phytenal}}
+
{{#set: reaction associated=CARBPSYN-RXN|GLUTAMIN-RXN|RXN-13202|RXN-14196|RXN-16909|RXN-16910}}
−
{{#set: molecular weight=294.52   }}
+
{{#set: pathway associated=PWY-4984|GLUTAMINDEG-PWY|ARGSYN-PWY|PWY-5154|ARGSYNBSUB-PWY|PWY-7693|PWY-7400|PWY-5686|CITRULBIO-PWY}}
−
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
+
−
{{#set: consumed by=RXN66-479}}
+

Latest revision as of 19:18, 21 March 2018

Gene Ec-10_006110

  • left end position:
    • 6197821
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6217558
  • centisome position:
    • 95.33665
  • Synonym(s):
    • Esi_0006_0183
    • Esi0006_0183
    • CPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_006110&oldid=25959"