Difference between revisions of "CPD-8619"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA-specific 2-thiouridyla...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 
* common name:
 
* common name:
−
** tRNA-specific 2-thiouridylase
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.8.1.13 EC-2.8.1.13]
+
** 429.662   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-23]]
−
** 1 [[Donor-H2]][c] '''+''' 1 [[TusE-S-sulfanylcysteine]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[tRNA-uridine34]][c] '''=>''' 1 [[tRNA-2-thiouridine34]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[TusE-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an reduced unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] '''+''' 1 ATP[c] '''+''' 1 a uridine34 in tRNA[c] '''=>''' 1 a 2-thiouridine34 in tRNA[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-L-cysteine[c] '''+''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-28_002930]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=tRNA-specific 2-thiouridylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
−
{{#set: ec number=EC-2.8.1.13}}
+
* HMDB : HMDB12166
−
{{#set: gene associated=Ec-28_002930}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: molecular weight=429.662    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN66-23}}

Latest revision as of 19:18, 21 March 2018

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 429.662
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8619&oldid=26018"