Difference between revisions of "RXN-16081"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JCZF...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16081 RXN-16081] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16081 RXN-16081] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] | |
| − | * | + | |
| − | ** 2- | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-17323]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17329]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 malonyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 adrenoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 3-oxo-tetracosatetraenoyl-CoA[c] '''+''' 1 CO2[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] | ||
| + | ** '''13''' reactions found over '''13''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.1}} | |
| − | + | {{#set: in pathway=PWY-7726}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Reaction RXN-16081
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MALONYL-COA[c] + 1 PROTON[c] + 1 CPD-17323[c] => 1 CO-A[c] + 1 CPD-17329[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 malonyl-CoA[c] + 1 H+[c] + 1 adrenoyl-CoA[c] => 1 coenzyme A[c] + 1 3-oxo-tetracosatetraenoyl-CoA[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
- PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
- 13 reactions found over 13 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
