Difference between revisions of "RXN-10"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10 RXN-10] == * direction: ** LEFT-TO-RIGHT * common name: ** argininosuccinate synthetase * ec...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10 RXN-10] ==
−
* smiles:
+
* direction:
−
** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M
+
 
* common name:
 
* common name:
−
** cyclic-AMP
+
** argininosuccinate synthetase
−
* molecular weight:
+
* ec number:
−
** 328.201   
+
** [http://enzyme.expasy.org/EC/6.3.4.5 EC-6.3.4.5]
 
* Synonym(s):
 
* Synonym(s):
−
** cyclic 3',5'-AMP
 
−
** 3',5'-cyclic AMP
 
−
** adenosine cyclic-3',5'-monophosphate
 
−
** adenosine cyclic-monophosphate
 
−
** adenosine-cyclic-phosphoric-acid
 
−
** cAMP
 
−
** adenosine-cyclic-phosphate
 
−
** adenosine-3',5'-monophosphate
 
−
** adenosine 3',5'-cyclic phosphate
 
−
** adenosine-3',5'-cyclic monophosphate
 
−
** cyclic-3',5'-adenosine monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[ADENYLATECYC-RXN]]
+
** 1 [[L-ASPARTATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[O-UREIDOHOMOSERINE]][c] '''=>''' 1 [[CANAVANINOSUCCINATE]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-aspartate[c] '''+''' 1 ATP[c] '''+''' 1 O-ureidohomoserine[c] '''=>''' 1 canavaninosuccinate[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_001870]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 60-92-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 1484809
+
{{#set: common name=argininosuccinate synthetase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-6.3.4.5}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059571 7059571]
+
{{#set: gene associated=Ec-01_001870}}
−
* HMDB : HMDB00058
+
{{#set: in pathway=PWY-5}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00575 C00575]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.5415746.html 5415746]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58165 58165]
+
−
* METABOLIGHTS : MTBLC58165
+
−
{{#set: smiles=C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34))))}}
+
−
{{#set: inchi key=InChIKey=IVOMOUWHDPKRLL-KQYNXXCUSA-M}}
+
−
{{#set: common name=cyclic-AMP}}
+
−
{{#set: molecular weight=328.201    }}
+
−
{{#set: common name=cyclic 3',5'-AMP|3',5'-cyclic AMP|adenosine cyclic-3',5'-monophosphate|adenosine cyclic-monophosphate|adenosine-cyclic-phosphoric-acid|cAMP|adenosine-cyclic-phosphate|adenosine-3',5'-monophosphate|adenosine 3',5'-cyclic phosphate|adenosine-3',5'-cyclic monophosphate|cyclic-3',5'-adenosine monophosphate}}
+
−
{{#set: produced by=ADENYLATECYC-RXN}}
+

Latest revision as of 19:19, 21 March 2018

Reaction RXN-10

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • argininosuccinate synthetase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5, canavanine biosynthesis: PWY-5
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10&oldid=26080"