Difference between revisions of "Cis-delta7-3-oxo-cerotoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-oxo-cerotoyl-ACPs cis-delta7-3-oxo-cerotoyl-ACPs] == * common name: ** a cis-delta...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-oxo-cerotoyl-ACPs cis-delta7-3-oxo-cerotoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a cis-delta7-3-oxo-C26:1-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN1G-364]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a cis-delta7-3-oxo-C26:1-[acp]}} | |
| − | + | {{#set: consumed by=RXN1G-364}} | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite cis-delta7-3-oxo-cerotoyl-ACPs
- common name:
- a cis-delta7-3-oxo-C26:1-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a cis-delta7-3-oxo-C26:1-[acp" cannot be used as a page name in this wiki.
