Difference between revisions of "RIBULOSE-5P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L |
* common name: | * common name: | ||
| − | ** | + | ** D-ribulose 5-phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ribulose-5P |
| − | ** | + | ** D-ribulose-5-P |
| − | ** | + | ** ribulose-5-P |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9952]] | ||
| + | * [[6PGLUCONDEHYDROG-RXN]] | ||
| + | * [[RXN-3341]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RIBULP3EPIM-RXN]] | ||
| + | * [[PHOSPHORIBULOKINASE-RXN]] | ||
| + | * [[RIB5PISOM-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 4151-19-3 | ||
| + | * BIGG : 34237 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21144996 21144996] |
| + | * HMDB : HMDB00618 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00199 C00199] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.20015724.html 20015724] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58121 58121] |
| − | * | + | * METABOLIGHTS : MTBLC58121 |
| − | + | {{#set: smiles=C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=D-ribulose 5-phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=228.095 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=ribulose-5P|D-ribulose-5-P|ribulose-5-P}} |
| − | {{#set: common name= | + | {{#set: consumed by=DIOHBUTANONEPSYN-RXN}} |
| − | {{#set: consumed by=RXN- | + | {{#set: produced by=RXN-9952|6PGLUCONDEHYDROG-RXN|RXN-3341}} |
| + | {{#set: reversible reaction associated=RIBULP3EPIM-RXN|PHOSPHORIBULOKINASE-RXN|RIB5PISOM-RXN}} | ||
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite RIBULOSE-5P
- smiles:
- C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O
- inchi key:
- InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-L
- common name:
- D-ribulose 5-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- ribulose-5P
- D-ribulose-5-P
- ribulose-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 4151-19-3
- BIGG : 34237
- PUBCHEM:
- HMDB : HMDB00618
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58121
"C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.
