Difference between revisions of "CPD-4126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S2O3 S2O3] == * smiles: ** O=S(=O)([O-])S * inchi key: ** InChIKey=DHCDFWKWKRSZHF-UHFFFAOYSA-M...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 5-dehydroavenasterol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 410.682 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4210]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-4209]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724575 23724575] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB06852 |
| − | {{#set: common name= | + | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}} |
| − | + | {{#set: common name=5-dehydroavenasterol}} | |
| − | {{#set: consumed by= | + | {{#set: molecular weight=410.682 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-4210}} |
| + | {{#set: produced by=RXN-4209}} | ||
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite CPD-4126
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
- common name:
- 5-dehydroavenasterol
- molecular weight:
- 410.682
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
