Difference between revisions of "CPD-14808"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETONE ACETONE] == * smiles: ** CC(=O)C * inchi key: ** InChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(C(C(C(C(C1O)O)=O)O)O)O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N |
* common name: | * common name: | ||
| − | ** | + | ** scyllo-inosose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-keto-myo-inositol |
| − | ** 2- | + | ** 2,4,6/3,5-pentahydroxycyclohexanone |
| − | ** | + | ** 2-inosose |
| + | ** 2-keto-scyllo-inositol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] |
| − | + | {{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=scyllo-inosose}} |
| − | {{#set: common name= | + | {{#set: molecular weight=178.141 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-14808
- smiles:
- C1(C(C(C(C(C1O)O)=O)O)O)O
- inchi key:
- InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
- common name:
- scyllo-inosose
- molecular weight:
- 178.141
- Synonym(s):
- 2-keto-myo-inositol
- 2,4,6/3,5-pentahydroxycyclohexanone
- 2-inosose
- 2-keto-scyllo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
