Difference between revisions of "CYCLOARTENOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=p-his-tRNAS p-his-tRNAS] == * common name: ** p-tRNAHis * Synonym(s): == Reaction(s) known to...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** cycloartenol |
| + | * molecular weight: | ||
| + | ** 426.724 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 9β,19-cyclo-24-lanosten-3β-ol | ||
| + | ** cycloart-24(25)-enol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4021]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYCLOARTENOL-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 469-38-5 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657627 90657627] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902] | ||
| + | * HMDB : HMDB36591 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | ||
| + | {{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}} | ||
| + | {{#set: common name=cycloartenol}} | ||
| + | {{#set: molecular weight=426.724 }} | ||
| + | {{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}} | ||
| + | {{#set: consumed by=RXN-4021}} | ||
| + | {{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CYCLOARTENOL
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
- inchi key:
- InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
- common name:
- cycloartenol
- molecular weight:
- 426.724
- Synonym(s):
- 9β,19-cyclo-24-lanosten-3β-ol
- cycloart-24(25)-enol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.
