Difference between revisions of "RXN-11356"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] == * direction: ** LEFT-TO-RIGHT * common name: ** zeta-carotene desaturase, c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** zeta-carotene desaturase, chloroplast precursor |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ζ-carotene desaturase |
− | ** | + | ** ZDS |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-7526]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[CPD-7524]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 9,9'-di-cis-ζ-carotene[c] '''+''' 1 an electron-transfer quinone[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 7,9,9'-cis-neurosporene[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-02_004660]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=zeta-carotene desaturase, chloroplast precursor}} | |
− | + | {{#set: common name=ζ-carotene desaturase|ZDS}} | |
− | + | {{#set: gene associated=Ec-02_004660}} | |
− | + | {{#set: in pathway=PWY-6475}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:23, 21 March 2018
Contents
Reaction RXN-11356
- direction:
- LEFT-TO-RIGHT
- common name:
- zeta-carotene desaturase, chloroplast precursor
- Synonym(s):
- ζ-carotene desaturase
- ZDS
Reaction Formula
- With identifiers:
- 1 CPD-7526[c] + 1 ETR-Quinones[c] => 1 ETR-Quinols[c] + 1 CPD-7524[c]
- With common name(s):
- 1 9,9'-di-cis-ζ-carotene[c] + 1 an electron-transfer quinone[c] => 1 an electron-transfer quinol[c] + 1 7,9,9'-cis-neurosporene[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_004660
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
- 4 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome