Difference between revisions of "PWY-5669"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5669 PWY-5669] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5669 PWY-5669] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
+
** phosphatidylethanolamine biosynthesis I
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-14]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PHOSPHASERSYN-RXN]]
* [[RXN66-13]]
+
** 1 associated gene(s):
* [[RXN-13707]]
+
*** [[Ec-01_005920]]
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHASERDECARB-RXN PHOSPHASERDECARB-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5669 PWY-5669]
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=412.698    }}
+
{{#set: common name=phosphatidylethanolamine biosynthesis I}}
{{#set: consumed by=RXN66-14}}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN66-13|RXN-13707}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 19:24, 21 March 2018

Pathway PWY-5669

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links