Difference between revisions of "CPD-13187"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_007610 == * Synonym(s): ** Esi_0562_0010 ** Esi0562_0010 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == |
| + | * smiles: | ||
| + | ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M | ||
| + | * common name: | ||
| + | ** unsaturated gellan tetrasaccharide | ||
| + | * molecular weight: | ||
| + | ** 645.544 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12270]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940141 52940141] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63254 63254] | ||
| + | {{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))}} | ||
| + | {{#set: inchi key=InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M}} | ||
| + | {{#set: common name=unsaturated gellan tetrasaccharide}} | ||
| + | {{#set: molecular weight=645.544 }} | ||
| + | {{#set: common name=β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}} | ||
| + | {{#set: consumed by=RXN-12270}} | ||
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite CPD-13187
- smiles:
- CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))
- inchi key:
- InChIKey=JMDPLHPAGLYHCI-DPADXCMISA-M
- common name:
- unsaturated gellan tetrasaccharide
- molecular weight:
- 645.544
- Synonym(s):
- β-D-4-deoxy-Δ4,5-GlcAp-(1→4)-β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)OC4(OC(C([O-])=O)=CC(O)C(O)4)))" cannot be used as a page name in this wiki.
