Difference between revisions of "CPD-15530"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] |
| − | ** | + | * inchi key: |
| + | ** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-glucuronate |
| + | * molecular weight: | ||
| + | ** 193.133 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** aldehydo-D-glucuronic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14693]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953] |
| − | {{#set: common name= | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}} |
| − | {{#set: | + | {{#set: common name=aldehydo-D-glucuronate}} |
| − | {{#set: | + | {{#set: molecular weight=193.133 }} |
| + | {{#set: common name=aldehydo-D-glucuronic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-14693}} | ||
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-15530
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
- common name:
- aldehydo-D-glucuronate
- molecular weight:
- 193.133
- Synonym(s):
- aldehydo-D-glucuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
