Difference between revisions of "Ec-01 004650"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-L-AMINO-ACID 5-L-GLUTAMYL-L-AMINO-ACID] == * common name: ** an (γ-L-glutamy...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-L-AMINO-ACID 5-L-GLUTAMYL-L-AMINO-ACID] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an (γ-L-glutamyl)-L-amino acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 5-L-glutamyl-L-amino acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-6601]] | ||
| + | * [[RXN66-336]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an (γ-L-glutamyl)-L-amino acid}} | |
| − | + | {{#set: common name=a 5-L-glutamyl-L-amino acid}} | |
| − | + | {{#set: consumed by=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN}} | |
| − | + | {{#set: produced by=RXN-6601|RXN66-336}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 20:50, 17 March 2018
Contents
Metabolite 5-L-GLUTAMYL-L-AMINO-ACID
- common name:
- an (γ-L-glutamyl)-L-amino acid
- Synonym(s):
- a 5-L-glutamyl-L-amino acid
