Difference between revisions of "PWY-882"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-ascorbate biosynthesis I (L-galactose pathway) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin C biosynthesis |
| + | ** ascorbic acid biosynthesis | ||
| + | ** L-ascorbic acid biosynthesis I | ||
| + | ** Smirnoff-Wheeler pathway | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''7''' reactions found over '''8''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[2.7.7.13-RXN]] |
| − | == Reaction(s) | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[MANNPISOM-RXN]] | ||
| + | ** 4 associated gene(s): | ||
| + | *** [[Ec-20_000830]] | ||
| + | *** [[Ec-28_000080]] | ||
| + | *** [[Ec-28_000050]] | ||
| + | *** [[Ec-27_005440]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[PHOSMANMUT-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-17_001480]] | ||
| + | *** [[Ec-08_004630]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN-1882]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-06_004510]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN-1884]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Ec-27_006410]] | ||
| + | *** [[Ec-14_001520]] | ||
| + | *** [[Ec-12_007760]] | ||
| + | *** [[Ec-27_000770]] | ||
| + | *** [[Ec-27_001700]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXNQT-4141]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-15_001960]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXNQT-4142]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-21_004120]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-882 PWY-882] |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | {{#set: | + | {{#set: common name=L-ascorbate biosynthesis I (L-galactose pathway)}} |
| − | {{#set: | + | {{#set: common name=vitamin C biosynthesis|ascorbic acid biosynthesis|L-ascorbic acid biosynthesis I|Smirnoff-Wheeler pathway}} |
| − | {{#set: common name= | + | {{#set: reaction found=7}} |
| − | {{#set: | + | {{#set: total reaction=8}} |
| − | {{#set: | + | {{#set: completion rate=88.0}} |
| − | {{#set: | + | |
Latest revision as of 19:26, 21 March 2018
Pathway PWY-882
- taxonomic range:
- common name:
- L-ascorbate biosynthesis I (L-galactose pathway)
- Synonym(s):
- vitamin C biosynthesis
- ascorbic acid biosynthesis
- L-ascorbic acid biosynthesis I
- Smirnoff-Wheeler pathway
Reaction(s) found
7 reactions found over 8 reactions in the full pathway
- 2.7.7.13-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- MANNPISOM-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- PHOSMANMUT-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1882
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1884
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- RXNQT-4141
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXNQT-4142
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
