Difference between revisions of "MANNIDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNIDEG-PWY MANNIDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNIDEG-PWY MANNIDEG-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
− | ** | + | ** mannitol degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''1''' reactions in the full pathway |
− | + | * [[MANNPDEHYDROG-RXN]] | |
− | * [[ | + | ** 3 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-23_000570]] |
+ | *** [[Ec-18_001290]] | ||
+ | *** [[Ec-04_003690]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=MANNIDEG-PWY MANNIDEG-PWY] |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2763}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-4751}} |
− | {{#set: | + | {{#set: common name=mannitol degradation I}} |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=1}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
Latest revision as of 20:26, 21 March 2018
Pathway MANNIDEG-PWY
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- MANNPDEHYDROG-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: