Difference between revisions of "PWY-5083"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5083 PWY-5083] ==
−
* smiles:
+
* taxonomic range:
−
** C1(NC=NC=1CC(CO)[N+])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
−
** histidinol
+
** NAD/NADH phosphorylation and dephosphorylation
−
* molecular weight:
+
−
** 142.18   
+
 
* Synonym(s):
 
* Synonym(s):
−
** histidol
 
−
** L-histidinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-8001]]
+
'''4''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[NAD-KIN-RXN]]
−
* [[HISTIDPHOS-RXN]]
+
** 3 associated gene(s):
−
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
+
*** [[Ec-08_006010]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-18_003910]]
−
* [[HISTOLDEHYD-RXN]]
+
*** [[Ec-22_000250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
** 15 associated gene(s):
 +
*** [[Ec-21_001150]]
 +
*** [[Ec-19_001720]]
 +
*** [[Ec-20_001030]]
 +
*** [[Ec-08_005450]]
 +
*** [[Ec-01_000420]]
 +
*** [[Ec-21_003400]]
 +
*** [[Ec-10_001380]]
 +
*** [[Ec-02_006350]]
 +
*** [[Ec-21_004880]]
 +
*** [[Ec-06_007580]]
 +
*** [[Ec-10_005810]]
 +
*** [[Ec-03_000900]]
 +
*** [[Ec-18_003900]]
 +
*** [[Ec-01_008630]]
 +
*** [[Ec-05_005740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRNUTRANSHYDROGEN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-01_007000]]
 +
*** [[Ec-21_003320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-5822]]
 +
** 13 associated gene(s):
 +
*** [[Ec-21_005990]]
 +
*** [[Ec-19_002110]]
 +
*** [[Ec-19_000870]]
 +
*** [[Ec-20_002470]]
 +
*** [[Ec-07_000930]]
 +
*** [[Ec-24_000520]]
 +
*** [[Ec-05_000260]]
 +
*** [[Ec-05_004740]]
 +
*** [[Ec-27_003870]]
 +
*** [[Ec-20_003560]]
 +
*** [[Ec-00_000940]]
 +
*** [[Ec-26_006410]]
 +
*** [[Ec-21_003560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=NADH-KINASE-RXN NADH-KINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7703 RXN-7703]
 
== External links  ==
 
== External links  ==
−
* CAS : 501-28-0
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5083 PWY-5083]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: taxonomic range=TAX-4751}}
−
* KNAPSACK : C00007479
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB03431
+
{{#set: common name=NAD/NADH phosphorylation and dephosphorylation}}
−
* LIGAND-CPD:
+
{{#set: reaction found=4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
{{#set: total reaction=6}}
−
* CHEBI:
+
{{#set: completion rate=67.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
−
* BIGG : 36226
+
−
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
−
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
−
{{#set: common name=histidinol}}
+
−
{{#set: molecular weight=142.18    }}
+
−
{{#set: common name=histidol|L-histidinol}}
+
−
{{#set: consumed by=RXN-8001}}
+
−
{{#set: produced by=HISTIDPHOS-RXN|HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.}}
+
−
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-5083

  • taxonomic range:
  • common name:
    • NAD/NADH phosphorylation and dephosphorylation
  • Synonym(s):

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5083&oldid=26935"