Difference between revisions of "Ec-01 005220"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Ec-01_005220 == * left end position: ** 4497052 * transcription direction: ** POSITIVE * right end position: ** 4501486 * centisome position: ** 43.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_005220 == |
− | * | + | * left end position: |
− | ** | + | ** 4497052 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4501486 |
− | * | + | * centisome position: |
− | ** | + | ** 43.58101 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0018_0080 | ||
+ | ** Esi0018_0080 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RIBOKIN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | == | + | * Reaction: [[RXN-14223]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[RIBOKIN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4497052}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4501486}} | |
− | + | {{#set: centisome position=43.58101 }} | |
− | + | {{#set: common name=Esi_0018_0080|Esi0018_0080}} | |
− | + | {{#set: reaction associated=RIBOKIN-RXN|RXN-14223}} | |
− | + | {{#set: pathway associated=RIBOKIN-PWY}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:26, 21 March 2018
Gene Ec-01_005220
- left end position:
- 4497052
- transcription direction:
- POSITIVE
- right end position:
- 4501486
- centisome position:
- 43.58101
- Synonym(s):
- Esi_0018_0080
- Esi0018_0080
Reactions associated
- Reaction: RIBOKIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14223
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome