Difference between revisions of "MALONYL-ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] == * common name: ** a malonyl-[acp] * Synonym(s): ** malonyl-[acyl-ca...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] ==
* smiles:
+
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
* inchi key:
+
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
+
 
* common name:
 
* common name:
** betanidin quinone
+
** a malonyl-[acp]
* molecular weight:
+
** 384.301   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** malonyl-[acyl-carrier protein]
 +
** malonyl-S-ACP
 +
** malonyl-acyl-carrier-protein
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16629]]
 +
* [[RXN-11474]]
 +
* [[RXN-9535]]
 +
* [[RXN-14972]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-11479]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[RXN-9527]]
 +
* [[RXN0-2141]]
 +
* [[2.3.1.179-RXN]]
 +
* [[RXN-9523]]
 +
* [[RXN3O-1803]]
 +
* [[RXN-10654]]
 +
* [[RXN-9539]]
 +
* [[RXN-10658]]
 +
* [[RXN-9531]]
 +
* [[RXN-9516]]
 +
* [[RXN-16615]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8635]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.3.1.41-RXN]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN1G-460]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a malonyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+
{{#set: common name=malonyl-[acyl-carrier protein]|malonyl-S-ACP|malonyl-acyl-carrier-protein}}
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: consumed by=RXN-16629|RXN-11474|RXN-9535|RXN-14972|3-OXOACYL-ACP-SYNTH-RXN|RXN-16621|RXN-16625|RXN-11479|3-OXOACYL-ACP-SYNTH-BASE-RXN|RXN-9527|RXN0-2141|2.3.1.179-RXN|RXN-9523|RXN3O-1803|RXN-10654|RXN-9539|RXN-10658|RXN-9531|RXN-9516|RXN-16615}}
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
+
{{#set: reversible reaction associated=2.3.1.41-RXN|RXN-8349_PLANTCYC|RXN1G-460|MALONYL-COA-ACP-TRANSACYL-RXN}}
{{#set: common name=betanidin quinone}}
+
{{#set: molecular weight=384.301    }}
+
{{#set: produced by=RXN-8635}}
+

Latest revision as of 19:26, 21 March 2018

Metabolite MALONYL-ACP

  • common name:
    • a malonyl-[acp]
  • Synonym(s):
    • malonyl-[acyl-carrier protein]
    • malonyl-S-ACP
    • malonyl-acyl-carrier-protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a malonyl-[acp" cannot be used as a page name in this wiki.
"malonyl-[acyl-carrier protein" cannot be used as a page name in this wiki.