Difference between revisions of "PWY-6027"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6027 PWY-6027] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4071 TAX-40...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6027 PWY-6027] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4071 TAX-4071] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** capsiconiate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''4''' reactions in the full pathway |
| − | * | + | * [[RXN-1106]] |
| − | * | + | ** 3 associated gene(s): |
| − | * | + | *** [[Ec-12_005240]] |
| − | * | + | *** [[Ec-12_001350]] |
| − | * [[ | + | *** [[Ec-23_001220]] |
| − | * | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[orthology-aragem]] |
| − | * [[ | + | == Reaction(s) not found == |
| − | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2602 RXN-2602] |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8926 RXN-8926] | |
| − | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9719 RXN-9719] |
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | * [ | + | |
| − | + | ||
| − | * [ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4071}} | |
| − | + | {{#set: common name=capsiconiate biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:27, 21 March 2018
Pathway PWY-6027
- taxonomic range:
- common name:
- capsiconiate biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-1106
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
