Difference between revisions of "CPD-4"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6673 PWY-6673] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == * smiles: ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3))) |
+ | * inchi key: | ||
+ | ** InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** molybdopterin |
+ | * molecular weight: | ||
+ | ** 392.321 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** MPT | ||
+ | ** pyranopterin-dithiolate | ||
+ | ** ene-dithiol pyranopterin | ||
+ | ** H2Dtpp-mP | ||
+ | ** [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-8344]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-8342]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266731 45266731] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58698 58698] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05924 C05924] | ||
+ | * HMDB : HMDB02206 | ||
+ | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))}} | ||
+ | {{#set: inchi key=InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K}} | ||
+ | {{#set: common name=molybdopterin}} | ||
+ | {{#set: molecular weight=392.321 }} | ||
+ | {{#set: common name=MPT|pyranopterin-dithiolate|ene-dithiol pyranopterin|H2Dtpp-mP|[(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate}} | ||
+ | {{#set: consumed by=RXN-8344}} | ||
+ | {{#set: produced by=RXN-8342}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-4
- smiles:
- C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))
- inchi key:
- InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K
- common name:
- molybdopterin
- molecular weight:
- 392.321
- Synonym(s):
- MPT
- pyranopterin-dithiolate
- ene-dithiol pyranopterin
- H2Dtpp-mP
- [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))" cannot be used as a page name in this wiki.
"(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate" cannot be used as a page name in this wiki.