Difference between revisions of "PWY-6549"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549] ==
−
* smiles:
+
* taxonomic range:
−
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
* inchi key:
+
−
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
+
** L-glutamine biosynthesis III
−
* molecular weight:
+
−
** 1039.92   
+
 
* Synonym(s):
 
* Synonym(s):
−
** oxopentenyl-cyclopentane-octanoyl-CoA
+
** L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)
−
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
+
−
** OPC-8:0-CoA
+
−
** OPC8-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10696]]
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[CITSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-00_000720]]
 +
*** [[Ec-26_004630]]
 +
*** [[Ec-27_004970]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-15_004120]]
 +
*** [[Ec-15_004110]]
 +
*** [[Ec-09_000640]]
 +
*** [[Ec-21_003610]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-18_001310]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ISOCITRATE-DEHYDROGENASE-NAD+-RXN ISOCITRATE-DEHYDROGENASE-NAD+-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
+
{{#set: common name=L-glutamine biosynthesis III}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: common name=L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)}}
−
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
+
{{#set: reaction found=8}}
−
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
+
{{#set: total reaction=9}}
−
{{#set: molecular weight=1039.92    }}
+
{{#set: completion rate=89.0}}
−
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
+
−
{{#set: consumed by=RXN-10696}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-6549

  • taxonomic range:
  • common name:
    • L-glutamine biosynthesis III
  • Synonym(s):
    • L-glutamine biosynthesis (nitrogen remobilization from senescing leaves)

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6549&oldid=27109"