Difference between revisions of "PWY-5103"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5103 PWY-5103] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5103 PWY-5103] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** L- | + | ** L-isoleucine biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[ACETOOHBUTREDUCTOISOM-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-09_003170]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[ACETOOHBUTSYN-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-20_001390]] | ||
+ | *** [[Ec-12_005520]] | ||
+ | *** [[Ec-12_005560]] | ||
+ | *** [[Ec-01_007170]] | ||
+ | *** [[Ec-12_005530]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-03_000220]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=METHYLASPARTATE-MUTASE-RXN METHYLASPARTATE-MUTASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7746 RXN-7746] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7751 RXN-7751] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=L-isoleucine biosynthesis III}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=57.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=L- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-5103
- taxonomic range:
- common name:
- L-isoleucine biosynthesis III
- Synonym(s):
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- ACETOOHBUTREDUCTOISOM-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETOOHBUTSYN-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- BRANCHED-CHAINAMINOTRANSFERILEU-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- DIHYDROXYMETVALDEHYDRAT-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: