Difference between revisions of "PWY-5406"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == * smiles: ** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5406 PWY-5406] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5406 PWY-5406] ==
* smiles:
+
* taxonomic range:
** CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M
+
 
* common name:
 
* common name:
** isopenicillin N
+
** divinyl ether biosynthesis I
* molecular weight:
+
** 358.388   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-lipoxygenase and divinyl ether synthase pathway
 +
** 9-LOX and DES pathway
 +
** colneleate biosynthesis
 +
** colnelenate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''4''' reactions in the full pathway
* [[1.21.3.1-RXN]]
+
* [[RXN-8497]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-03_000010]]
 +
*** [[Ec-20_003630]]
 +
*** [[Ec-20_003620]]
 +
*** [[Ec-03_000020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8495 RXN-8495]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8496 RXN-8496]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8498 RXN-8498]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244809 25244809]
+
{{#set: common name=divinyl ether biosynthesis I}}
* CHEBI:
+
{{#set: common name=9-lipoxygenase and divinyl ether synthase pathway|9-LOX and DES pathway|colneleate biosynthesis|colnelenate biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58399 58399]
+
{{#set: reaction found=1}}
* METABOLIGHTS : MTBLC58399
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=25.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05557 C05557]
+
{{#set: smiles=CC1(C)(S[CH]2(C(C(=O)N(C(C(=O)[O-])1)2)NC(=O)CCCC([N+])C(=O)[O-]))}}
+
{{#set: inchi key=InChIKey=MIFYHUACUWQUKT-GTQWGBSQSA-M}}
+
{{#set: common name=isopenicillin N}}
+
{{#set: molecular weight=358.388    }}
+
{{#set: produced by=1.21.3.1-RXN}}
+

Latest revision as of 19:29, 21 March 2018

Pathway PWY-5406

  • taxonomic range:
  • common name:
    • divinyl ether biosynthesis I
  • Synonym(s):
    • 9-lipoxygenase and divinyl ether synthase pathway
    • 9-LOX and DES pathway
    • colneleate biosynthesis
    • colnelenate biosynthesis

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links