Difference between revisions of "Ec-16 002160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Gene == Gene Ec-16_002160 == * left end position: ** 2359865 * transcription direction: ** POSITIVE * right end position: ** 2366190 * centisome position: ** 44.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_002160 == |
− | * | + | * left end position: |
− | ** | + | ** 2359865 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2366190 |
− | * | + | * centisome position: |
− | ** | + | ** 44.211655 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0047_0048 | ||
+ | ** Esi0047_0048 | ||
+ | ** Taz1 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.3.1.23-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-15036]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-15066]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16041]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16042]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16043]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16044]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16045]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16150]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16151]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16152]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16157]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16158]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17688]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-9670]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7053]] | ||
+ | * [[PWY-5353]] | ||
+ | * [[PWY-6433]] | ||
+ | * [[PWY-5368]] | ||
+ | * [[PWY-5995]] | ||
+ | * [[PWY-7470]] | ||
+ | * [[PWY-7416]] | ||
+ | * [[PWY-7409]] | ||
+ | * [[PWY-6803]] | ||
+ | * [[PWY-6958]] | ||
+ | * [[PWY-7618]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2359865}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2366190}} | |
− | + | {{#set: centisome position=44.211655 }} | |
− | + | {{#set: common name=Esi_0047_0048|Esi0047_0048|Taz1}} | |
− | + | {{#set: reaction associated=2.3.1.23-RXN|RXN-15036|RXN-15066|RXN-16041|RXN-16042|RXN-16043|RXN-16044|RXN-16045|RXN-16150|RXN-16151|RXN-16152|RXN-16157|RXN-16158|RXN-17688|RXN-9670}} | |
− | + | {{#set: pathway associated=PWY-7053|PWY-5353|PWY-6433|PWY-5368|PWY-5995|PWY-7470|PWY-7416|PWY-7409|PWY-6803|PWY-6958|PWY-7618}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:30, 21 March 2018
Gene Ec-16_002160
- left end position:
- 2359865
- transcription direction:
- POSITIVE
- right end position:
- 2366190
- centisome position:
- 44.211655
- Synonym(s):
- Esi_0047_0048
- Esi0047_0048
- Taz1
Reactions associated
- Reaction: 2.3.1.23-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15036
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15066
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16041
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16042
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16043
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16044
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16045
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16150
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16151
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16152
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16157
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16158
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-17688
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-9670
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome