Difference between revisions of "CPD-19158"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13299 RXN-13299] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
 +
* common name:
 +
** 3-oxo-(9Z)-hexadecenoyl-CoA
 +
* molecular weight:
 +
** 1013.883   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-16:1-Δ9-CoA
 +
** 3-oxo-9-cis-hexadecenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-10283]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-14276]][c]
+
* [[RXN-17790]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 3-oxo-behenoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 (3R)-3-hydroxy-behenoyl-CoA[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
** '''4''' reactions found over '''16''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[gap-filling]]
+
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
*** Tool: [[meneco]]
+
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: ec number=EC-1.1.1.330}}
+
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
{{#set: in pathway=PWY-7036}}
+
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
{{#set: reconstruction category=gap-filling}}
+
{{#set: molecular weight=1013.883    }}
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
{{#set: reconstruction tool=meneco}}
+
{{#set: produced by=RXN-17790}}
{{#set: reconstruction comment=added for gapfilling}}
+

Latest revision as of 20:30, 21 March 2018

Metabolite CPD-19158

  • smiles:
    • CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
  • common name:
    • 3-oxo-(9Z)-hexadecenoyl-CoA
  • molecular weight:
    • 1013.883
  • Synonym(s):
    • 3-oxo-16:1-Δ9-CoA
    • 3-oxo-9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.