Difference between revisions of "Ec-04 003460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-04_003460 == * left end position: ** 3490234 * transcription direction: ** POSITIVE * right end position: ** 3497016 * centisome position: ** 53.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] ==
+
== Gene Ec-04_003460 ==
−
* smiles:
+
* left end position:
−
** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
+
** 3490234
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-selenocystathionine
+
** 3497016
−
* molecular weight:
+
* centisome position:
−
** 269.159    
+
** 53.598183    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0080_0066
 +
** Esi0080_0066
 +
** ACC synthase
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12729]]
+
* Reaction: [[4.4.1.14-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-15137]]
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[ETHYL-PWY]]
 +
* [[PWY-7270]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3490234}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3497016}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226]
+
{{#set: centisome position=53.598183    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0080_0066|Esi0080_0066|ACC synthase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699]
+
{{#set: reaction associated=4.4.1.14-RXN}}
−
* HMDB : HMDB06343
+
{{#set: pathway associated=ETHYL-PWY|PWY-7270}}
−
{{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}}
+
−
{{#set: common name=L-selenocystathionine}}
+
−
{{#set: molecular weight=269.159    }}
+
−
{{#set: consumed by=RXN-12729}}
+
−
{{#set: reversible reaction associated=RXN-15137}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-04_003460

  • left end position:
    • 3490234
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3497016
  • centisome position:
    • 53.598183
  • Synonym(s):
    • Esi_0080_0066
    • Esi0080_0066
    • ACC synthase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_003460&oldid=27424"