Difference between revisions of "PWY-6398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANINE GUANINE] == * smiles: ** C2(=NC1(=C(N=C(NC(=O)1)N)N2)) * inchi key: ** InChIKey=UYTPUPD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** melatonin degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''5''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-11056]] |
− | * [[ | + | ** 3 associated gene(s): |
− | + | *** [[Ec-00_001320]] | |
− | * [[ | + | *** [[Ec-26_003280]] |
− | * [[ | + | *** [[Ec-01_010880]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11057]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-01_010880]] | ||
+ | *** [[Ec-00_001320]] | ||
+ | *** [[Ec-26_003280]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11058]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-06_007320]] | ||
+ | *** [[Ec-06_007310]] | ||
+ | *** [[Ec-00_005410]] | ||
+ | *** [[Ec-06_007300]] | ||
+ | *** [[Ec-26_003630]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11059]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-26_003630]] | ||
+ | *** [[Ec-00_005410]] | ||
+ | *** [[Ec-06_007320]] | ||
+ | *** [[Ec-06_007310]] | ||
+ | *** [[Ec-06_007300]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11060 RXN-11060] | ||
== External links == | == External links == | ||
− | + | * LIGAND-MAP: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00380 map00380] | |
− | + | {{#set: taxonomic range=TAX-7742}} | |
− | + | {{#set: common name=melatonin degradation I}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=5}} | |
− | * LIGAND- | + | {{#set: completion rate=80.0}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:31, 21 March 2018
Pathway PWY-6398
- taxonomic range:
- common name:
- melatonin degradation I
- Synonym(s):
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- RXN-11056
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11057
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11058
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11059
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP: