Difference between revisions of "RXN-17475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17475 RXN-17475] == * direction: ** REVERSIBLE * common name: ** ClpP/crotonase-like domain **...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17475 RXN-17475] ==
−
* smiles:
+
* direction:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N
+
 
* common name:
 
* common name:
−
** aldehydo-D-galactose
+
** ClpP/crotonase-like domain
−
* molecular weight:
+
** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
−
** 180.157   
+
** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[D-3-HYDROXYACYL-COA]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[CIS-D2-ENOYL-COA]][c]
−
* [[RXN-14409]]
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxyacyl-CoA[c] '''<=>''' 1 H2O[c] '''+''' 1 a cis-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-16_001250]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-16_003560]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01582 C01582]
+
{{#set: common name=ClpP/crotonase-like domain}}
−
* CHEBI:
+
{{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17118 17118]
+
{{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-4.2.1.17}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3037556 3037556]
+
{{#set: gene associated=Ec-06_001380|Ec-16_001250|Ec-14_006530|Ec-16_003560}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KCDKBNATSA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=aldehydo-D-galactose}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=180.157    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: reversible reaction associated=RXN-14409}}
+

Latest revision as of 19:31, 21 March 2018

Reaction RXN-17475

  • direction:
    • REVERSIBLE
  • common name:
    • ClpP/crotonase-like domain
    • Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
    • enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17475&oldid=27465"