Difference between revisions of "DNA-Cytosines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Cytosines DNA-Cytosines] == * common name: ** a cytosine in DNA * Synonym(s): ** a DNA dcyt...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == |
| + | * smiles: | ||
| + | ** C(C1(C=CC(=CC=1)O))(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=FJKROLUGYXJWQN-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxybenzoate |
| + | * molecular weight: | ||
| + | ** 137.115 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** p-hydroxybenzoate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9222]] |
| − | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
| + | * [[RXN-9003]] | ||
| + | * [[RXN-9230]] | ||
| + | * [[2.5.1.39-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11368]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 99-96-7 |
| − | {{#set: common name= | + | * BIGG : 34069 |
| − | {{#set: consumed by= | + | * DRUGBANK : DB04242 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=135 135] | ||
| + | * HMDB : HMDB00500 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00156 C00156] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.132.html 132] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30763 30763] | ||
| + | * METABOLIGHTS : MTBLC17879 | ||
| + | {{#set: smiles=C(C1(C=CC(=CC=1)O))(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=FJKROLUGYXJWQN-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=4-hydroxybenzoate}} | ||
| + | {{#set: molecular weight=137.115 }} | ||
| + | {{#set: common name=p-hydroxybenzoate}} | ||
| + | {{#set: consumed by=RXN-9222|4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|RXN-9003|RXN-9230|2.5.1.39-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-11368}} | ||
Revision as of 20:51, 17 March 2018
Contents
Metabolite 4-hydroxybenzoate
- smiles:
- C(C1(C=CC(=CC=1)O))(=O)[O-]
- inchi key:
- InChIKey=FJKROLUGYXJWQN-UHFFFAOYSA-M
- common name:
- 4-hydroxybenzoate
- molecular weight:
- 137.115
- Synonym(s):
- p-hydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 99-96-7
- BIGG : 34069
- DRUGBANK : DB04242
- PUBCHEM:
- HMDB : HMDB00500
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17879
"C(C1(C=CC(=CC=1)O))(=O)[O-" cannot be used as a page name in this wiki.
