Difference between revisions of "Ec-01 004380"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Ec-01_004380 == * left end position: ** 3771201 * transcription direction: ** POSITIVE * right end position: ** 3795011 * centisome position: ** 36.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] ==
+
== Gene Ec-01_004380 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 3771201
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA
+
** 3795011
−
* molecular weight:
+
* centisome position:
−
** 1102.034    
+
** 36.546776    
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA
+
** Esi_0532_0004
 +
** Esi0532_0004
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17114]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17113]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=3771201}}
−
{{#set: inchi key=InChIKey=UYOKHWFEUAJFMG-UIYHDVLFSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA}}
+
{{#set: right end position=3795011}}
−
{{#set: molecular weight=1102.034   }}
+
{{#set: centisome position=36.546776   }}
−
{{#set: common name=(2E,6Z,9Z,12Z,15Z,18Z)-tetracosa-2,6,9,12,15,18-hexaenoyl-CoA}}
+
{{#set: common name=Esi_0532_0004|Esi0532_0004}}
−
{{#set: consumed by=RXN-17114}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: produced by=RXN-17113}}
+

Latest revision as of 19:31, 21 March 2018

Gene Ec-01_004380

  • left end position:
    • 3771201
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3795011
  • centisome position:
    • 36.546776
  • Synonym(s):
    • Esi_0532_0004
    • Esi0532_0004

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_004380&oldid=27537"